C21H26N4O2 — CID 150494948
8-[(2,6-dimethylphenyl)methylamino]-N-ethoxy-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 150494948) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 8-[(2,6-dimethylphenyl)methylamino]-N-ethoxy-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-[(2,6-dimethylphenyl)methylamino]-N-ethoxy-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 150494948 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 8-[(2,6-dimethylphenyl)methylamino]-N-ethoxy-2,3-dimethylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCONC(=O)c1cc(NCc2c(C)cccc2C)c2nc(C)c(C)n2c1 |
| InChI | InChI=1S/C21H26N4O2/c1-6-27-24-21(26)17-10-19(20-23-15(4)16(5)25(20)12-17)22-11-18-13(2)8-7-9-14(18)3/h7-10,12,22H,6,11H2,1-5H3,(H,24,26) |
| InChIKey | HWOZZBNBEKJQLL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|