C16H14F2N4O — CID 150516978
2-[(4S)-3,3-difluoropiperidin-4-yl]oxy-5-pyrimidin-4-ylbenzonitrile (PubChem CID 150516978) has the molecular formula C16H14F2N4O and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-[(4S)-3,3-difluoropiperidin-4-yl]oxy-5-pyrimidin-4-ylbenzonitrile.
| Compound Name | 2-[(4S)-3,3-difluoropiperidin-4-yl]oxy-5-pyrimidin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 150516978 |
| Molecular Formula | C16H14F2N4O |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[(4S)-3,3-difluoropiperidin-4-yl]oxy-5-pyrimidin-4-ylbenzonitrile |
| SMILES | N#Cc1cc(-c2ccncn2)ccc1O[C@H]1CCNCC1(F)F |
| InChI | InChI=1S/C16H14F2N4O/c17-16(18)9-20-6-4-15(16)23-14-2-1-11(7-12(14)8-19)13-3-5-21-10-22-13/h1-3,5,7,10,15,20H,4,6,9H2/t15-/m0/s1 |
| InChIKey | IBADQFMKYYNBAL-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |