C10H22NOS+ — CID 15052281
[(4R)-3,3-dimethyl-2-(2-methylpropyl)-1,3-thiazolidin-3-ium-4-yl]methanol (PubChem CID 15052281) has the molecular formula C10H22NOS+ and a molecular weight of 204.36 g/mol. Its IUPAC name is [(4R)-3,3-dimethyl-2-(2-methylpropyl)-1,3-thiazolidin-3-ium-4-yl]methanol.
| Compound Name | [(4R)-3,3-dimethyl-2-(2-methylpropyl)-1,3-thiazolidin-3-ium-4-yl]methanol |
|---|---|
| PubChem CID | 15052281 |
| Molecular Formula | C10H22NOS+ |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [(4R)-3,3-dimethyl-2-(2-methylpropyl)-1,3-thiazolidin-3-ium-4-yl]methanol |
| SMILES | CC(C)CC1SC[C@@H](CO)[N+]1(C)C |
| InChI | InChI=1S/C10H22NOS/c1-8(2)5-10-11(3,4)9(6-12)7-13-10/h8-10,12H,5-7H2,1-4H3/q+1/t9-,10?/m1/s1 |
| InChIKey | BEVXALMOJJEBQK-YHMJZVADSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|