About di(nonoxy)borinic acid
di(nonoxy)borinic acid (PubChem CID 150530087) has the molecular formula C18H39BO3
and a molecular weight of 314.32 g/mol. Its IUPAC name is di(nonoxy)borinic acid.
Molecular Properties
| Compound Name | di(nonoxy)borinic acid |
| PubChem CID | 150530087 |
| Molecular Formula | C18H39BO3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | di(nonoxy)borinic acid |
| SMILES | CCCCCCCCCOB(O)OCCCCCCCCC |
| InChI | InChI=1S/C18H39BO3/c1-3-5-7-9-11-13-15-17-21-19(20)22-18-16-14-12-10-8-6-4-2/h20H,3-18H2,1-2H3 |
| InChIKey | JLJNCEZSNYTYQV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(nonoxy)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(nonoxy)borinic acid?
The IUPAC name of di(nonoxy)borinic acid (CID 150530087) is di(nonoxy)borinic acid.
What is the SMILES notation for di(nonoxy)borinic acid?
The canonical SMILES for di(nonoxy)borinic acid is CCCCCCCCCOB(O)OCCCCCCCCC.
What is the InChIKey of di(nonoxy)borinic acid?
The InChIKey is JLJNCEZSNYTYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39BO3/c1-3-5-7-9-11-13-15-17-21-19(20)22-18-16-14-12-10-8-6-4-2/h20H,3-18H2,1-2H3.
What are the key properties of di(nonoxy)borinic acid?
di(nonoxy)borinic acid has a molecular weight of 314.32 g/mol, XLogP of 5.50, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for di(nonoxy)borinic acid is sourced from PubChem (CID 150530087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).