About pentadecoxymethylboronic acid
pentadecoxymethylboronic acid (PubChem CID 151152394) has the molecular formula C16H35BO3
and a molecular weight of 286.26 g/mol. Its IUPAC name is pentadecoxymethylboronic acid.
Molecular Properties
| Compound Name | pentadecoxymethylboronic acid |
| PubChem CID | 151152394 |
| Molecular Formula | C16H35BO3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | pentadecoxymethylboronic acid |
| SMILES | CCCCCCCCCCCCCCCOCB(O)O |
| InChI | InChI=1S/C16H35BO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-16-17(18)19/h18-19H,2-16H2,1H3 |
| InChIKey | MYMJDWKQVPQWGD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pentadecoxymethylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecoxymethylboronic acid?
The IUPAC name of pentadecoxymethylboronic acid (CID 151152394) is pentadecoxymethylboronic acid.
What is the SMILES notation for pentadecoxymethylboronic acid?
The canonical SMILES for pentadecoxymethylboronic acid is CCCCCCCCCCCCCCCOCB(O)O.
What is the InChIKey of pentadecoxymethylboronic acid?
The InChIKey is MYMJDWKQVPQWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35BO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-16-17(18)19/h18-19H,2-16H2,1H3.
What are the key properties of pentadecoxymethylboronic acid?
pentadecoxymethylboronic acid has a molecular weight of 286.26 g/mol, XLogP of 4.11, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecoxymethylboronic acid is sourced from PubChem (CID 151152394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).