About butoxymethylboronic acid
butoxymethylboronic acid (PubChem CID 53421464) has the molecular formula C5H13BO3
and a molecular weight of 131.97 g/mol. Its IUPAC name is butoxymethylboronic acid.
Molecular Properties
| Compound Name | butoxymethylboronic acid |
| PubChem CID | 53421464 |
| Molecular Formula | C5H13BO3 |
| Molecular Weight | 131.97 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | butoxymethylboronic acid |
| SMILES | CCCCOCB(O)O |
| InChI | InChI=1S/C5H13BO3/c1-2-3-4-9-5-6(7)8/h7-8H,2-5H2,1H3 |
| InChIKey | XSFRFQIIJZCSIN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.97 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxymethylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxymethylboronic acid?
The IUPAC name of butoxymethylboronic acid (CID 53421464) is butoxymethylboronic acid.
What is the SMILES notation for butoxymethylboronic acid?
The canonical SMILES for butoxymethylboronic acid is CCCCOCB(O)O.
What is the InChIKey of butoxymethylboronic acid?
The InChIKey is XSFRFQIIJZCSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13BO3/c1-2-3-4-9-5-6(7)8/h7-8H,2-5H2,1H3.
What are the key properties of butoxymethylboronic acid?
butoxymethylboronic acid has a molecular weight of 131.97 g/mol, XLogP of -0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxymethylboronic acid is sourced from PubChem (CID 53421464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).