C12H20O3S3 — CID 15054691
[5-(2-methylsulfanyl-1,3-dithian-2-yl)-5-oxopentyl] acetate (PubChem CID 15054691) has the molecular formula C12H20O3S3 and a molecular weight of 308.49 g/mol. Its IUPAC name is [5-(2-methylsulfanyl-1,3-dithian-2-yl)-5-oxopentyl] acetate.
| Compound Name | [5-(2-methylsulfanyl-1,3-dithian-2-yl)-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 15054691 |
| Molecular Formula | C12H20O3S3 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [5-(2-methylsulfanyl-1,3-dithian-2-yl)-5-oxopentyl] acetate |
| SMILES | CSC1(C(=O)CCCCOC(C)=O)SCCCS1 |
| InChI | InChI=1S/C12H20O3S3/c1-10(13)15-7-4-3-6-11(14)12(16-2)17-8-5-9-18-12/h3-9H2,1-2H3 |
| InChIKey | PYKBCMSUHHGZOF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|