C14H22O5S4 — CID 102080605
[2,6-bis(ethoxycarbothioylsulfanyl)-5-oxohexyl] acetate (PubChem CID 102080605) has the molecular formula C14H22O5S4 and a molecular weight of 398.59 g/mol. Its IUPAC name is [2,6-bis(ethoxycarbothioylsulfanyl)-5-oxohexyl] acetate.
| Compound Name | [2,6-bis(ethoxycarbothioylsulfanyl)-5-oxohexyl] acetate |
|---|---|
| PubChem CID | 102080605 |
| Molecular Formula | C14H22O5S4 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [2,6-bis(ethoxycarbothioylsulfanyl)-5-oxohexyl] acetate |
| SMILES | CCOC(=S)SCC(=O)CCC(COC(C)=O)SC(=S)OCC |
| InChI | InChI=1S/C14H22O5S4/c1-4-17-13(20)22-9-11(16)6-7-12(8-19-10(3)15)23-14(21)18-5-2/h12H,4-9H2,1-3H3 |
| InChIKey | VJSDCGNCTYCXCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|