C19H32O5S4 — CID 11619729
[1,5-bis(ethoxycarbothioylsulfanyl)-2-oxoundecan-6-yl] acetate (PubChem CID 11619729) has the molecular formula C19H32O5S4 and a molecular weight of 468.73 g/mol. Its IUPAC name is [1,5-bis(ethoxycarbothioylsulfanyl)-2-oxoundecan-6-yl] acetate.
| Compound Name | [1,5-bis(ethoxycarbothioylsulfanyl)-2-oxoundecan-6-yl] acetate |
|---|---|
| PubChem CID | 11619729 |
| Molecular Formula | C19H32O5S4 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [1,5-bis(ethoxycarbothioylsulfanyl)-2-oxoundecan-6-yl] acetate |
| SMILES | CCCCCC(OC(C)=O)C(CCC(=O)CSC(=S)OCC)SC(=S)OCC |
| InChI | InChI=1S/C19H32O5S4/c1-5-8-9-10-16(24-14(4)20)17(28-19(26)23-7-3)12-11-15(21)13-27-18(25)22-6-2/h16-17H,5-13H2,1-4H3 |
| InChIKey | MDUYMDMXUHTKGL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|