C25H40O9S4 — CID 102080610
[5,13-diacetyloxy-6,12-bis(ethoxycarbothioylsulfanyl)-9-oxotridecyl] acetate (PubChem CID 102080610) has the molecular formula C25H40O9S4 and a molecular weight of 612.85 g/mol. Its IUPAC name is [5,13-diacetyloxy-6,12-bis(ethoxycarbothioylsulfanyl)-9-oxotridecyl] acetate.
| Compound Name | [5,13-diacetyloxy-6,12-bis(ethoxycarbothioylsulfanyl)-9-oxotridecyl] acetate |
|---|---|
| PubChem CID | 102080610 |
| Molecular Formula | C25H40O9S4 |
| Molecular Weight | 612.85 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | [5,13-diacetyloxy-6,12-bis(ethoxycarbothioylsulfanyl)-9-oxotridecyl] acetate |
| SMILES | CCOC(=S)SC(CCC(=O)CCC(SC(=S)OCC)C(CCCCOC(C)=O)OC(C)=O)COC(C)=O |
| InChI | InChI=1S/C25H40O9S4/c1-6-30-24(35)37-21(16-33-18(4)27)13-11-20(29)12-14-23(38-25(36)31-7-2)22(34-19(5)28)10-8-9-15-32-17(3)26/h21-23H,6-16H2,1-5H3 |
| InChIKey | INIAAYONDAIFCJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|