C25H24N4O2 — CID 150552449
3-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-ethylamino]phenyl]prop-2-enal (PubChem CID 150552449) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-ethylamino]phenyl]prop-2-enal.
| Compound Name | 3-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-ethylamino]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 150552449 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-ethylamino]phenyl]prop-2-enal |
| SMILES | CCN(Cc1cc(C)cc(-n2nc3ccccc3n2)c1O)c1ccc(C=CC=O)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-3-28(21-12-10-19(11-13-21)7-6-14-30)17-20-15-18(2)16-24(25(20)31)29-26-22-8-4-5-9-23(22)27-29/h4-16,31H,3,17H2,1-2H3 |
| InChIKey | IIDWSDIXAMRYLT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|