C27H26N4O5 — CID 155783812
7-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-methylamino]phenyl]-1,5-dioxocane-2,4-dione (PubChem CID 155783812) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is 7-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-methylamino]phenyl]-1,5-dioxocane-2,4-dione.
| Compound Name | 7-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-methylamino]phenyl]-1,5-dioxocane-2,4-dione |
|---|---|
| PubChem CID | 155783812 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 7-[4-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl-methylamino]phenyl]-1,5-dioxocane-2,4-dione |
| SMILES | Cc1cc(CN(C)c2ccc(C3COC(=O)CC(=O)OC3)cc2)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C27H26N4O5/c1-17-11-19(27(34)24(12-17)31-28-22-5-3-4-6-23(22)29-31)14-30(2)21-9-7-18(8-10-21)20-15-35-25(32)13-26(33)36-16-20/h3-12,20,34H,13-16H2,1-2H3 |
| InChIKey | IBUPYDNKBDWIIK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|