C20H16F5N3O2 — CID 150572456
1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methyl-3-[(3,4,5-trifluorophenyl)methyl]urea (PubChem CID 150572456) has the molecular formula C20H16F5N3O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is 1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methyl-3-[(3,4,5-trifluorophenyl)methyl]urea.
| Compound Name | 1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methyl-3-[(3,4,5-trifluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 150572456 |
| Molecular Formula | C20H16F5N3O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methyl-3-[(3,4,5-trifluorophenyl)methyl]urea |
| SMILES | C[C@@H](c1c[nH]c(=O)c2cc(F)c(F)cc12)N(C)C(=O)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H16F5N3O2/c1-9(13-8-26-19(29)12-6-15(22)14(21)5-11(12)13)28(2)20(30)27-7-10-3-16(23)18(25)17(24)4-10/h3-6,8-9H,7H2,1-2H3,(H,26,29)(H,27,30)/t9-/m0/s1 |
| InChIKey | IMCVRCMKHRTBIO-VIFPVBQESA-N |
| XLogP | 4.13 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|