C18H15ClF2N4O2 — CID 151981383
3-(2-chloro-4-pyridinyl)-1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methylurea (PubChem CID 151981383) has the molecular formula C18H15ClF2N4O2 and a molecular weight of 392.79 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methylurea.
| Compound Name | 3-(2-chloro-4-pyridinyl)-1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 151981383 |
| Molecular Formula | C18H15ClF2N4O2 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-1-[(1S)-1-(6,7-difluoro-1-oxo-2H-isoquinolin-4-yl)ethyl]-1-methylurea |
| SMILES | C[C@@H](c1c[nH]c(=O)c2cc(F)c(F)cc12)N(C)C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C18H15ClF2N4O2/c1-9(25(2)18(27)24-10-3-4-22-16(19)5-10)13-8-23-17(26)12-7-15(21)14(20)6-11(12)13/h3-9H,1-2H3,(H,23,26)(H,22,24,27)/t9-/m0/s1 |
| InChIKey | UCSYHWKTTMXOEB-VIFPVBQESA-N |
| XLogP | 4.08 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|