C20H23F2N3O5 — CID 150577491
(3S,4S)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(2R,3R)-3-hydroxybutan-2-yl]piperidine-3-carboxylic acid (PubChem CID 150577491) has the molecular formula C20H23F2N3O5 and a molecular weight of 423.42 g/mol. Its IUPAC name is (3S,4S)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(2R,3R)-3-hydroxybutan-2-yl]piperidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(2R,3R)-3-hydroxybutan-2-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 150577491 |
| Molecular Formula | C20H23F2N3O5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3S,4S)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(2R,3R)-3-hydroxybutan-2-yl]piperidine-3-carboxylic acid |
| SMILES | C[C@H]([C@@H](C)O)N1CC[C@H](NC(=O)c2cc(-c3ccc(F)cc3F)on2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C20H23F2N3O5/c1-10(11(2)26)25-6-5-16(14(9-25)20(28)29)23-19(27)17-8-18(30-24-17)13-4-3-12(21)7-15(13)22/h3-4,7-8,10-11,14,16,26H,5-6,9H2,1-2H3,(H,23,27)(H,28,29)/t10-,11-,14+,16+/m1/s1 |
| InChIKey | INCUXUJJIDBTKF-XYJYNPGVSA-N |
| XLogP | 1.89 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |