C22H25F2N3O4 — CID 151912713
(3R,4R)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(1S,2R)-2-methylcyclopentyl]piperidine-3-carboxylic acid (PubChem CID 151912713) has the molecular formula C22H25F2N3O4 and a molecular weight of 433.46 g/mol. Its IUPAC name is (3R,4R)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(1S,2R)-2-methylcyclopentyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(1S,2R)-2-methylcyclopentyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 151912713 |
| Molecular Formula | C22H25F2N3O4 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (3R,4R)-4-[[5-(2,4-difluorophenyl)-1,2-oxazole-3-carbonyl]amino]-1-[(1S,2R)-2-methylcyclopentyl]piperidine-3-carboxylic acid |
| SMILES | C[C@@H]1CCC[C@@H]1N1CC[C@@H](NC(=O)c2cc(-c3ccc(F)cc3F)on2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C22H25F2N3O4/c1-12-3-2-4-19(12)27-8-7-17(15(11-27)22(29)30)25-21(28)18-10-20(31-26-18)14-6-5-13(23)9-16(14)24/h5-6,9-10,12,15,17,19H,2-4,7-8,11H2,1H3,(H,25,28)(H,29,30)/t12-,15-,17-,19+/m1/s1 |
| InChIKey | SVCOUCQGAFLZKH-XKHMPKOFSA-N |
| XLogP | 3.31 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |