C22H24F3N3O4 — CID 138676271
(3S,4S)-1-[(1S,2S)-2-methylcyclopentyl]-4-[[5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carbonyl]amino]piperidine-3-carboxylic acid (PubChem CID 138676271) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is (3S,4S)-1-[(1S,2S)-2-methylcyclopentyl]-4-[[5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carbonyl]amino]piperidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[(1S,2S)-2-methylcyclopentyl]-4-[[5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carbonyl]amino]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138676271 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (3S,4S)-1-[(1S,2S)-2-methylcyclopentyl]-4-[[5-(2,4,6-trifluorophenyl)-1,2-oxazole-3-carbonyl]amino]piperidine-3-carboxylic acid |
| SMILES | C[C@H]1CCC[C@@H]1N1CC[C@H](NC(=O)c2cc(-c3c(F)cc(F)cc3F)on2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C22H24F3N3O4/c1-11-3-2-4-18(11)28-6-5-16(13(10-28)22(30)31)26-21(29)17-9-19(32-27-17)20-14(24)7-12(23)8-15(20)25/h7-9,11,13,16,18H,2-6,10H2,1H3,(H,26,29)(H,30,31)/t11-,13-,16-,18-/m0/s1 |
| InChIKey | LXIVTPCUZSGUIE-BMGJLBJMSA-N |
| XLogP | 3.45 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |