C28H36F2N4O3 — CID 164607300
N-[(3R,4R)-3-[[(1R)-1-cyclobutylethyl]carbamoyl]-1-[(1R,2R)-2-methylcyclopentyl]piperidin-4-yl]-3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxamide (PubChem CID 164607300) has the molecular formula C28H36F2N4O3 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[(3R,4R)-3-[[(1R)-1-cyclobutylethyl]carbamoyl]-1-[(1R,2R)-2-methylcyclopentyl]piperidin-4-yl]-3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(3R,4R)-3-[[(1R)-1-cyclobutylethyl]carbamoyl]-1-[(1R,2R)-2-methylcyclopentyl]piperidin-4-yl]-3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 164607300 |
| Molecular Formula | C28H36F2N4O3 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[(3R,4R)-3-[[(1R)-1-cyclobutylethyl]carbamoyl]-1-[(1R,2R)-2-methylcyclopentyl]piperidin-4-yl]-3-(2,4-difluorophenyl)-1,2-oxazole-5-carboxamide |
| SMILES | C[C@@H]1CCC[C@H]1N1CC[C@@H](NC(=O)c2cc(-c3ccc(F)cc3F)no2)[C@H](C(=O)N[C@H](C)C2CCC2)C1 |
| InChI | InChI=1S/C28H36F2N4O3/c1-16-5-3-8-25(16)34-12-11-23(21(15-34)27(35)31-17(2)18-6-4-7-18)32-28(36)26-14-24(33-37-26)20-10-9-19(29)13-22(20)30/h9-10,13-14,16-18,21,23,25H,3-8,11-12,15H2,1-2H3,(H,31,35)(H,32,36)/t16-,17-,21-,23-,25-/m1/s1 |
| InChIKey | AMIXSPMNGKFRHD-YPUBDDMNSA-N |
| XLogP | 4.53 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |