C25H32F2N4O3 — CID 138676313
5-(2,4-difluorophenyl)-N-[(3R,4R)-3-(dimethylcarbamoyl)-1-[(1S,2R)-2-ethylcyclopentyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 138676313) has the molecular formula C25H32F2N4O3 and a molecular weight of 474.55 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-N-[(3R,4R)-3-(dimethylcarbamoyl)-1-[(1S,2R)-2-ethylcyclopentyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-3-(dimethylcarbamoyl)-1-[(1S,2R)-2-ethylcyclopentyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 138676313 |
| Molecular Formula | C25H32F2N4O3 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-3-(dimethylcarbamoyl)-1-[(1S,2R)-2-ethylcyclopentyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | CC[C@@H]1CCC[C@@H]1N1CC[C@@H](NC(=O)c2cc(-c3ccc(F)cc3F)on2)[C@H](C(=O)N(C)C)C1 |
| InChI | InChI=1S/C25H32F2N4O3/c1-4-15-6-5-7-22(15)31-11-10-20(18(14-31)25(33)30(2)3)28-24(32)21-13-23(34-29-21)17-9-8-16(26)12-19(17)27/h8-9,12-13,15,18,20,22H,4-7,10-11,14H2,1-3H3,(H,28,32)/t15-,18-,20-,22+/m1/s1 |
| InChIKey | BWYQDYFPGAJLFM-HBPKQZLHSA-N |
| XLogP | 3.71 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |