C31H36F2N4O4 — CID 138676117
5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 138676117) has the molecular formula C31H36F2N4O4 and a molecular weight of 566.65 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 138676117 |
| Molecular Formula | C31H36F2N4O4 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 5-(2,4-difluorophenyl)-N-[(3R,4R)-1-[(1R,2R)-2-hydroxycyclohexyl]-3-[methyl(2-phenylethyl)carbamoyl]piperidin-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | CN(CCc1ccccc1)C(=O)[C@@H]1CN([C@@H]2CCCC[C@H]2O)CC[C@H]1NC(=O)c1cc(-c2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C31H36F2N4O4/c1-36(15-13-20-7-3-2-4-8-20)31(40)23-19-37(27-9-5-6-10-28(27)38)16-14-25(23)34-30(39)26-18-29(41-35-26)22-12-11-21(32)17-24(22)33/h2-4,7-8,11-12,17-18,23,25,27-28,38H,5-6,9-10,13-16,19H2,1H3,(H,34,39)/t23-,25-,27-,28-/m1/s1 |
| InChIKey | DESVANVMNZGRCK-PDYROLRZSA-N |
| XLogP | 4.04 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |