C15H21NO5 — CID 150585771
[4-(2-methylpropoxycarbonylamino)phenyl] propan-2-yl carbonate (PubChem CID 150585771) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is [4-(2-methylpropoxycarbonylamino)phenyl] propan-2-yl carbonate.
| Compound Name | [4-(2-methylpropoxycarbonylamino)phenyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 150585771 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-(2-methylpropoxycarbonylamino)phenyl] propan-2-yl carbonate |
| SMILES | CC(C)COC(=O)Nc1ccc(OC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C15H21NO5/c1-10(2)9-19-14(17)16-12-5-7-13(8-6-12)21-15(18)20-11(3)4/h5-8,10-11H,9H2,1-4H3,(H,16,17) |
| InChIKey | IOUNLEYVVPHDDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|