C13H11FN2 — CID 150587654
2-[4-(2,5-dihydropyridin-6-yl)-3-fluorophenyl]acetonitrile (PubChem CID 150587654) has the molecular formula C13H11FN2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-[4-(2,5-dihydropyridin-6-yl)-3-fluorophenyl]acetonitrile.
| Compound Name | 2-[4-(2,5-dihydropyridin-6-yl)-3-fluorophenyl]acetonitrile |
|---|---|
| PubChem CID | 150587654 |
| Molecular Formula | C13H11FN2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-[4-(2,5-dihydropyridin-6-yl)-3-fluorophenyl]acetonitrile |
| SMILES | N#CCc1ccc(C2=NCC=CC2)c(F)c1 |
| InChI | InChI=1S/C13H11FN2/c14-12-9-10(6-7-15)4-5-11(12)13-3-1-2-8-16-13/h1-2,4-5,9H,3,6,8H2 |
| InChIKey | IPEPKVPGXAEKQI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|