C19H15N3OS — CID 15059490
2-[2-(4-methyl-2-pyridinyl)phenyl]sulfinyl-1H-benzimidazole (PubChem CID 15059490) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-[2-(4-methyl-2-pyridinyl)phenyl]sulfinyl-1H-benzimidazole.
| Compound Name | 2-[2-(4-methyl-2-pyridinyl)phenyl]sulfinyl-1H-benzimidazole |
|---|---|
| PubChem CID | 15059490 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[2-(4-methyl-2-pyridinyl)phenyl]sulfinyl-1H-benzimidazole |
| SMILES | Cc1ccnc(-c2ccccc2S(=O)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C19H15N3OS/c1-13-10-11-20-17(12-13)14-6-2-5-9-18(14)24(23)19-21-15-7-3-4-8-16(15)22-19/h2-12H,1H3,(H,21,22) |
| InChIKey | UKZIFWBIJKBBOH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |