C24H23N3O5S — CID 15059508
ethyl 6-ethoxy-2-[2-(4-methoxy-2-pyridinyl)phenyl]sulfinyl-3H-benzimidazole-5-carboxylate (PubChem CID 15059508) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is ethyl 6-ethoxy-2-[2-(4-methoxy-2-pyridinyl)phenyl]sulfinyl-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 6-ethoxy-2-[2-(4-methoxy-2-pyridinyl)phenyl]sulfinyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 15059508 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | ethyl 6-ethoxy-2-[2-(4-methoxy-2-pyridinyl)phenyl]sulfinyl-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2[nH]c(S(=O)c3ccccc3-c3cc(OC)ccn3)nc2cc1OCC |
| InChI | InChI=1S/C24H23N3O5S/c1-4-31-21-14-20-19(13-17(21)23(28)32-5-2)26-24(27-20)33(29)22-9-7-6-8-16(22)18-12-15(30-3)10-11-25-18/h6-14H,4-5H2,1-3H3,(H,26,27) |
| InChIKey | DVELHEHQGZDKQI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |