C10H18S2 — CID 15059664
2-(4-methylpent-3-enyl)-1,3-dithiane (PubChem CID 15059664) has the molecular formula C10H18S2 and a molecular weight of 202.39 g/mol. Its IUPAC name is 2-(4-methylpent-3-enyl)-1,3-dithiane.
| Compound Name | 2-(4-methylpent-3-enyl)-1,3-dithiane |
|---|---|
| PubChem CID | 15059664 |
| Molecular Formula | C10H18S2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(4-methylpent-3-enyl)-1,3-dithiane |
| SMILES | CC(C)=CCCC1SCCCS1 |
| InChI | InChI=1S/C10H18S2/c1-9(2)5-3-6-10-11-7-4-8-12-10/h5,10H,3-4,6-8H2,1-2H3 |
| InChIKey | PHZMRVWUQFKBQF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|