C16H28O5 — CID 15059847
ethyl (2R,3R)-3-(7-hydroxyheptyl)-2-methoxy-5-methyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 15059847) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(7-hydroxyheptyl)-2-methoxy-5-methyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl (2R,3R)-3-(7-hydroxyheptyl)-2-methoxy-5-methyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 15059847 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | ethyl (2R,3R)-3-(7-hydroxyheptyl)-2-methoxy-5-methyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H](OC)[C@@H]1CCCCCCCO |
| InChI | InChI=1S/C16H28O5/c1-4-20-15(18)14-12(2)21-16(19-3)13(14)10-8-6-5-7-9-11-17/h13,16-17H,4-11H2,1-3H3/t13-,16-/m1/s1 |
| InChIKey | XHPILHFHEVDDEC-CZUORRHYSA-N |
| XLogP | 2.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|