C16H26O5 — CID 163108423
2-hydroxy-4-(1-hydroxy-8-methyl-6-oxodecyl)-3-methyl-2H-furan-5-one (PubChem CID 163108423) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-hydroxy-4-(1-hydroxy-8-methyl-6-oxodecyl)-3-methyl-2H-furan-5-one.
| Compound Name | 2-hydroxy-4-(1-hydroxy-8-methyl-6-oxodecyl)-3-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 163108423 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-hydroxy-4-(1-hydroxy-8-methyl-6-oxodecyl)-3-methyl-2H-furan-5-one |
| SMILES | CCC(C)CC(=O)CCCCC(O)C1=C(C)C(O)OC1=O |
| InChI | InChI=1S/C16H26O5/c1-4-10(2)9-12(17)7-5-6-8-13(18)14-11(3)15(19)21-16(14)20/h10,13,15,18-19H,4-9H2,1-3H3 |
| InChIKey | DVWRMCXUGNGXJU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|