C21H32O4 — CID 15059854
(Z)-7-[(2R,3R)-2-methoxy-5-methyl-4-[(E)-3-oxooct-1-enyl]-2,3-dihydrofuran-3-yl]hept-4-enal (PubChem CID 15059854) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (Z)-7-[(2R,3R)-2-methoxy-5-methyl-4-[(E)-3-oxooct-1-enyl]-2,3-dihydrofuran-3-yl]hept-4-enal.
| Compound Name | (Z)-7-[(2R,3R)-2-methoxy-5-methyl-4-[(E)-3-oxooct-1-enyl]-2,3-dihydrofuran-3-yl]hept-4-enal |
|---|---|
| PubChem CID | 15059854 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (Z)-7-[(2R,3R)-2-methoxy-5-methyl-4-[(E)-3-oxooct-1-enyl]-2,3-dihydrofuran-3-yl]hept-4-enal |
| SMILES | CCCCCC(=O)/C=C/C1=C(C)O[C@@H](OC)[C@@H]1CC/C=C\CCC=O |
| InChI | InChI=1S/C21H32O4/c1-4-5-9-12-18(23)14-15-19-17(2)25-21(24-3)20(19)13-10-7-6-8-11-16-22/h6-7,14-16,20-21H,4-5,8-13H2,1-3H3/b7-6-,15-14+/t20-,21-/m1/s1 |
| InChIKey | GJYBDSYVSDCRPS-OXHXJMCISA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|