C27H44O4 — CID 143150250
2-[(1R,3R,5E,7E,15S)-9-(1-methoxypropoxymethyl)-3,7,15-trimethyl-12-methylidene-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde (PubChem CID 143150250) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-[(1R,3R,5E,7E,15S)-9-(1-methoxypropoxymethyl)-3,7,15-trimethyl-12-methylidene-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,3R,5E,7E,15S)-9-(1-methoxypropoxymethyl)-3,7,15-trimethyl-12-methylidene-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 143150250 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2-[(1R,3R,5E,7E,15S)-9-(1-methoxypropoxymethyl)-3,7,15-trimethyl-12-methylidene-4-oxocyclohexadeca-5,7-dien-1-yl]acetaldehyde |
| SMILES | C=C1CCC(COC(CC)OC)/C=C(C)/C=C/C(=O)[C@H](C)C[C@H](CC=O)C[C@@H](C)CC1 |
| InChI | InChI=1S/C27H44O4/c1-7-27(30-6)31-19-25-12-10-20(2)8-9-21(3)16-24(14-15-28)18-23(5)26(29)13-11-22(4)17-25/h11,13,15,17,21,23-25,27H,2,7-10,12,14,16,18-19H2,1,3-6H3/b13-11+,22-17+/t21-,23+,24+,25?,27?/m0/s1 |
| InChIKey | ZVQXJSUKHUGFKX-PRPVYOLNSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|