C26H38O7 — CID 10434500
methyl (E)-7-[(3R)-3-(diacetyloxymethyl)-2-[(E)-oct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate (PubChem CID 10434500) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is methyl (E)-7-[(3R)-3-(diacetyloxymethyl)-2-[(E)-oct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate.
| Compound Name | methyl (E)-7-[(3R)-3-(diacetyloxymethyl)-2-[(E)-oct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 10434500 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | methyl (E)-7-[(3R)-3-(diacetyloxymethyl)-2-[(E)-oct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoate |
| SMILES | CCCCCC/C=C/C1=C(C/C=C/CCCC(=O)OC)C(=O)C[C@H]1C(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H38O7/c1-5-6-7-8-9-12-15-21-22(16-13-10-11-14-17-25(30)31-4)24(29)18-23(21)26(32-19(2)27)33-20(3)28/h10,12-13,15,23,26H,5-9,11,14,16-18H2,1-4H3/b13-10+,15-12+/t23-/m1/s1 |
| InChIKey | RNJJSSGGHTTZQY-FKBJDYRESA-N |
| XLogP | 5.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|