C18H15ClO6 — CID 150604895
2-(4-chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanedioic acid (PubChem CID 150604895) has the molecular formula C18H15ClO6 and a molecular weight of 362.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanedioic acid.
| Compound Name | 2-(4-chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanedioic acid |
|---|---|
| PubChem CID | 150604895 |
| Molecular Formula | C18H15ClO6 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)butanedioic acid |
| SMILES | O=C(O)C(c1ccc(Cl)cc1)C(C(=O)O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H15ClO6/c19-12-4-1-10(2-5-12)15(17(20)21)16(18(22)23)11-3-6-13-14(9-11)25-8-7-24-13/h1-6,9,15-16H,7-8H2,(H,20,21)(H,22,23) |
| InChIKey | ISQXPPKXCRFFRA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |