C10H10FN — CID 150606982
2-fluoro-6,7-dimethyl-6H-indole (PubChem CID 150606982) has the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. Its IUPAC name is 2-fluoro-6,7-dimethyl-6H-indole.
| Compound Name | 2-fluoro-6,7-dimethyl-6H-indole |
|---|---|
| PubChem CID | 150606982 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-fluoro-6,7-dimethyl-6H-indole |
| SMILES | CC1=C2N=C(F)C=C2C=CC1C |
| InChI | InChI=1S/C10H10FN/c1-6-3-4-8-5-9(11)12-10(8)7(6)2/h3-6H,1-2H3 |
| InChIKey | ITBUEKWJIWXLPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |