About 5-fluoro-2H-carbazole
5-fluoro-2H-carbazole (PubChem CID 139329693) has the molecular formula C12H8FN
and a molecular weight of 185.20 g/mol. Its IUPAC name is 5-fluoro-2H-carbazole.
Molecular Properties
| Compound Name | 5-fluoro-2H-carbazole |
| PubChem CID | 139329693 |
| Molecular Formula | C12H8FN |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5-fluoro-2H-carbazole |
| SMILES | Fc1cccc2c1=C1C=CCC=C1N=2 |
| InChI | InChI=1S/C12H8FN/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1,3-7H,2H2 |
| InChIKey | FQYQTBVGLWYECU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2H-carbazole?
The IUPAC name of 5-fluoro-2H-carbazole (CID 139329693) is 5-fluoro-2H-carbazole.
What is the SMILES notation for 5-fluoro-2H-carbazole?
The canonical SMILES for 5-fluoro-2H-carbazole is Fc1cccc2c1=C1C=CCC=C1N=2.
What is the InChIKey of 5-fluoro-2H-carbazole?
The InChIKey is FQYQTBVGLWYECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1,3-7H,2H2.
What are the key properties of 5-fluoro-2H-carbazole?
5-fluoro-2H-carbazole has a molecular weight of 185.20 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2H-carbazole is sourced from PubChem (CID 139329693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).