C24H29N5O — CID 150607332
3-(3-amino-1-phenyl-2H-pyrazin-6-yl)-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 150607332) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-(3-amino-1-phenyl-2H-pyrazin-6-yl)-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3-(3-amino-1-phenyl-2H-pyrazin-6-yl)-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 150607332 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 3-(3-amino-1-phenyl-2H-pyrazin-6-yl)-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | NC1=NC=C(c2cccc(C(=O)NCCN3CCCCC3)c2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C24H29N5O/c25-23-18-29(21-10-3-1-4-11-21)22(17-27-23)19-8-7-9-20(16-19)24(30)26-12-15-28-13-5-2-6-14-28/h1,3-4,7-11,16-17H,2,5-6,12-15,18H2,(H2,25,27)(H,26,30) |
| InChIKey | ITDNHJKYJHCVGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |