About [cyano(nitrooxy)amino] thiocyanate
[cyano(nitrooxy)amino] thiocyanate (PubChem CID 150613497) has the molecular formula C2N4O3S
and a molecular weight of 160.11 g/mol. Its IUPAC name is [cyano(nitrooxy)amino] thiocyanate.
Molecular Properties
| Compound Name | [cyano(nitrooxy)amino] thiocyanate |
| PubChem CID | 150613497 |
| Molecular Formula | C2N4O3S |
| Molecular Weight | 160.11 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | [cyano(nitrooxy)amino] thiocyanate |
| SMILES | N#CSN(C#N)O[N+](=O)[O-] |
| InChI | InChI=1S/C2N4O3S/c3-1-5(10-2-4)9-6(7)8 |
| InChIKey | IUKBIDNDLAHUAJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.11 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyano(nitrooxy)amino] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano(nitrooxy)amino] thiocyanate?
The IUPAC name of [cyano(nitrooxy)amino] thiocyanate (CID 150613497) is [cyano(nitrooxy)amino] thiocyanate.
What is the SMILES notation for [cyano(nitrooxy)amino] thiocyanate?
The canonical SMILES for [cyano(nitrooxy)amino] thiocyanate is N#CSN(C#N)O[N+](=O)[O-].
What is the InChIKey of [cyano(nitrooxy)amino] thiocyanate?
The InChIKey is IUKBIDNDLAHUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3S/c3-1-5(10-2-4)9-6(7)8.
What are the key properties of [cyano(nitrooxy)amino] thiocyanate?
[cyano(nitrooxy)amino] thiocyanate has a molecular weight of 160.11 g/mol, XLogP of 0.02, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano(nitrooxy)amino] thiocyanate is sourced from PubChem (CID 150613497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).