C9H9N3O7 — CID 150617261
2-[(2,6-dinitro-3-pyridinyl)oxy]-2-methylpropanoic acid (PubChem CID 150617261) has the molecular formula C9H9N3O7 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-[(2,6-dinitro-3-pyridinyl)oxy]-2-methylpropanoic acid.
| Compound Name | 2-[(2,6-dinitro-3-pyridinyl)oxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 150617261 |
| Molecular Formula | C9H9N3O7 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[(2,6-dinitro-3-pyridinyl)oxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc([N+](=O)[O-])nc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H9N3O7/c1-9(2,8(13)14)19-5-3-4-6(11(15)16)10-7(5)12(17)18/h3-4H,1-2H3,(H,13,14) |
| InChIKey | IVDPRTCXASTAJY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|