About 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate
3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate (PubChem CID 86693020) has the molecular formula C15H20N2O6
and a molecular weight of 324.33 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate |
| PubChem CID | 86693020 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])nc1C |
| InChI | InChI=1S/C15H20N2O6/c1-6-22-13(18)12(14(19)23-15(3,4)5)10-7-8-11(17(20)21)16-9(10)2/h7-8,12H,6H2,1-5H3 |
| InChIKey | CKCNXZTWWGIHAB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate (CID 86693020) is 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate is CCOC(=O)C(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])nc1C.
What is the InChIKey of 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate?
The InChIKey is CKCNXZTWWGIHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O6/c1-6-22-13(18)12(14(19)23-15(3,4)5)10-7-8-11(17(20)21)16-9(10)2/h7-8,12H,6H2,1-5H3.
What are the key properties of 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate?
3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate has a molecular weight of 324.33 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-ethyl 2-(2-methyl-6-nitro-3-pyridinyl)propanedioate is sourced from PubChem (CID 86693020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).