C10H15NS — CID 150620354
1-(1-bicyclo[2.2.1]hept-2-enyl)-3,4-dihydro-2H-1,3-thiazole (PubChem CID 150620354) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 1-(1-bicyclo[2.2.1]hept-2-enyl)-3,4-dihydro-2H-1,3-thiazole.
| Compound Name | 1-(1-bicyclo[2.2.1]hept-2-enyl)-3,4-dihydro-2H-1,3-thiazole |
|---|---|
| PubChem CID | 150620354 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-(1-bicyclo[2.2.1]hept-2-enyl)-3,4-dihydro-2H-1,3-thiazole |
| SMILES | C1=CC2(S3=CCNC3)CCC1C2 |
| InChI | InChI=1S/C10H15NS/c1-3-10(4-2-9(1)7-10)12-6-5-11-8-12/h1,3,6,9,11H,2,4-5,7-8H2 |
| InChIKey | IVTQTAWDBOZLQX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|