About 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate
2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate (PubChem CID 20649864) has the molecular formula C12H19NS2
and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate |
| PubChem CID | 20649864 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate |
| SMILES | CCCCNC(=S)SC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H19NS2/c1-2-3-6-13-12(14)15-11-8-9-4-5-10(11)7-9/h4-5,9-11H,2-3,6-8H2,1H3,(H,13,14) |
| InChIKey | LSRVWBBVEGWVFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate (CID 20649864) is 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate is CCCCNC(=S)SC1CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate?
The InChIKey is LSRVWBBVEGWVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS2/c1-2-3-6-13-12(14)15-11-8-9-4-5-10(11)7-9/h4-5,9-11H,2-3,6-8H2,1H3,(H,13,14).
What are the key properties of 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate?
2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate has a molecular weight of 241.42 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enyl N-butylcarbamodithioate is sourced from PubChem (CID 20649864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).