C13H21NS2 — CID 20649859
2-bicyclo[2.2.1]hept-5-enylmethyl N-butylcarbamodithioate (PubChem CID 20649859) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl N-butylcarbamodithioate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl N-butylcarbamodithioate |
|---|---|
| PubChem CID | 20649859 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl N-butylcarbamodithioate |
| SMILES | CCCCNC(=S)SCC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H21NS2/c1-2-3-6-14-13(15)16-9-12-8-10-4-5-11(12)7-10/h4-5,10-12H,2-3,6-9H2,1H3,(H,14,15) |
| InChIKey | UBUJDASBTUBZLO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|