C13H21NOS — CID 20649858
S-(2-bicyclo[2.2.1]hept-5-enylmethyl) N-butylcarbamothioate (PubChem CID 20649858) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is S-(2-bicyclo[2.2.1]hept-5-enylmethyl) N-butylcarbamothioate.
| Compound Name | S-(2-bicyclo[2.2.1]hept-5-enylmethyl) N-butylcarbamothioate |
|---|---|
| PubChem CID | 20649858 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | S-(2-bicyclo[2.2.1]hept-5-enylmethyl) N-butylcarbamothioate |
| SMILES | CCCCNC(=O)SCC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H21NOS/c1-2-3-6-14-13(15)16-9-12-8-10-4-5-11(12)7-10/h4-5,10-12H,2-3,6-9H2,1H3,(H,14,15) |
| InChIKey | PREKMYLFVGSCEE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|