C12H19NOS — CID 98177937
(1R,2S,4S)-N-(3-methylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98177937) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is (1R,2S,4S)-N-(3-methylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-(3-methylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98177937 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (1R,2S,4S)-N-(3-methylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CSCCCNC(=O)[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H19NOS/c1-15-6-2-5-13-12(14)11-8-9-3-4-10(11)7-9/h3-4,9-11H,2,5-8H2,1H3,(H,13,14)/t9-,10-,11-/m0/s1 |
| InChIKey | FJPHIDDLQQDJHH-DCAQKATOSA-N |
| XLogP | 2.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|