About methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate
methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate (PubChem CID 150623985) has the molecular formula C21H18ClNO4
and a molecular weight of 383.83 g/mol. Its IUPAC name is methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate |
| PubChem CID | 150623985 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CCc3c(oc4c(Cl)cccc4c3=O)C2)c1 |
| InChI | InChI=1S/C21H18ClNO4/c1-26-21(25)14-5-2-4-13(10-14)11-23-9-8-15-18(12-23)27-20-16(19(15)24)6-3-7-17(20)22/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | IWMPZPMGPBZTOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate?
The IUPAC name of methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate (CID 150623985) is methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate.
What is the SMILES notation for methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate?
The canonical SMILES for methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate is COC(=O)c1cccc(CN2CCc3c(oc4c(Cl)cccc4c3=O)C2)c1.
What is the InChIKey of methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate?
The InChIKey is IWMPZPMGPBZTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClNO4/c1-26-21(25)14-5-2-4-13(10-14)11-23-9-8-15-18(12-23)27-20-16(19(15)24)6-3-7-17(20)22/h2-7,10H,8-9,11-12H2,1H3.
What are the key properties of methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate?
methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate has a molecular weight of 383.83 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(9-chloro-5-oxo-3,4-dihydro-1H-chromeno[2,3-c]pyridin-2-yl)methyl]benzoate is sourced from PubChem (CID 150623985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).