C32H40N6O3 — CID 150631495
N-[3-[[3-(azepan-1-yl)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide (PubChem CID 150631495) has the molecular formula C32H40N6O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-[3-[[3-(azepan-1-yl)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[3-(azepan-1-yl)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 150631495 |
| Molecular Formula | C32H40N6O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | N-[3-[[3-(azepan-1-yl)-6-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2-pyridinyl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ccc2N2CCCCCC2)c1 |
| InChI | InChI=1S/C32H40N6O3/c1-4-31(39)33-24-10-9-11-26(22-24)41-32-28(38-16-7-5-6-8-17-38)14-15-30(35-32)34-27-13-12-25(23-29(27)40-3)37-20-18-36(2)19-21-37/h4,9-15,22-23H,1,5-8,16-21H2,2-3H3,(H,33,39)(H,34,35) |
| InChIKey | IXZBVAOGQKMSCW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|