C25H34S3 — CID 15063308
1-[1,3,3-tris(tert-butylsulfanyl)propa-1,2-dienyl]naphthalene (PubChem CID 15063308) has the molecular formula C25H34S3 and a molecular weight of 430.75 g/mol. Its IUPAC name is 1-[1,3,3-tris(tert-butylsulfanyl)propa-1,2-dienyl]naphthalene.
| Compound Name | 1-[1,3,3-tris(tert-butylsulfanyl)propa-1,2-dienyl]naphthalene |
|---|---|
| PubChem CID | 15063308 |
| Molecular Formula | C25H34S3 |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[1,3,3-tris(tert-butylsulfanyl)propa-1,2-dienyl]naphthalene |
| SMILES | CC(C)(C)SC(=C=C(SC(C)(C)C)c1cccc2ccccc12)SC(C)(C)C |
| InChI | InChI=1S/C25H34S3/c1-23(2,3)26-21(17-22(27-24(4,5)6)28-25(7,8)9)20-16-12-14-18-13-10-11-15-19(18)20/h10-16H,1-9H3 |
| InChIKey | UYJKNIVQDLIVCZ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |