About CID 150649855
CID 150649855 (PubChem CID 150649855) has the molecular formula H5N3O2S
and a molecular weight of 111.13 g/mol.
Molecular Properties
| Compound Name | CID 150649855 |
| PubChem CID | 150649855 |
| Molecular Formula | H5N3O2S |
| Molecular Weight | 111.13 g/mol |
| Exact Mass | 111.01 |
| IUPAC Name | — |
| SMILES | NNOS(N)=O |
| InChI | InChI=1S/H5N3O2S/c1-3-5-6(2)4/h3H,1-2H2 |
| InChIKey | HIVHTRBNEUIZMC-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.13 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 150649855 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150649855?
The IUPAC name of CID 150649855 (CID 150649855) is not available.
What is the SMILES notation for CID 150649855?
The canonical SMILES for CID 150649855 is NNOS(N)=O.
What is the InChIKey of CID 150649855?
The InChIKey is HIVHTRBNEUIZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/H5N3O2S/c1-3-5-6(2)4/h3H,1-2H2.
What are the key properties of CID 150649855?
CID 150649855 has a molecular weight of 111.13 g/mol, XLogP of -2.08, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150649855 is sourced from PubChem (CID 150649855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).