C21H18Cl2O2 — CID 150655549
2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol (PubChem CID 150655549) has the molecular formula C21H18Cl2O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol.
| Compound Name | 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol |
|---|---|
| PubChem CID | 150655549 |
| Molecular Formula | C21H18Cl2O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol |
| SMILES | CC(Cc1ccccc1)(c1ccc(O)c(Cl)c1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2O2/c1-21(13-14-5-3-2-4-6-14,15-7-9-19(24)17(22)11-15)16-8-10-20(25)18(23)12-16/h2-12,24-25H,13H2,1H3 |
| InChIKey | JCTVMKIERMFJEV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |