C35H33N7O5S — CID 150671966
[1-[6-amino-7-(2-azaspiro[3.3]heptane-2-carbonyl)-9-benzyl-8-oxopurin-2-yl]-3-propylfluoren-2-ylidene]sulfamic acid (PubChem CID 150671966) has the molecular formula C35H33N7O5S and a molecular weight of 663.76 g/mol. Its IUPAC name is [1-[6-amino-7-(2-azaspiro[3.3]heptane-2-carbonyl)-9-benzyl-8-oxopurin-2-yl]-3-propylfluoren-2-ylidene]sulfamic acid.
| Compound Name | [1-[6-amino-7-(2-azaspiro[3.3]heptane-2-carbonyl)-9-benzyl-8-oxopurin-2-yl]-3-propylfluoren-2-ylidene]sulfamic acid |
|---|---|
| PubChem CID | 150671966 |
| Molecular Formula | C35H33N7O5S |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | [1-[6-amino-7-(2-azaspiro[3.3]heptane-2-carbonyl)-9-benzyl-8-oxopurin-2-yl]-3-propylfluoren-2-ylidene]sulfamic acid |
| SMILES | CCCC1=CC2=c3ccccc3=CC2=C(c2nc(N)c3c(n2)n(Cc2ccccc2)c(=O)n3C(=O)N2CC3(CCC3)C2)C1=NS(=O)(=O)O |
| InChI | InChI=1S/C35H33N7O5S/c1-2-9-23-17-25-24-13-7-6-12-22(24)16-26(25)27(28(23)39-48(45,46)47)31-37-30(36)29-32(38-31)41(18-21-10-4-3-5-11-21)34(44)42(29)33(43)40-19-35(20-40)14-8-15-35/h3-7,10-13,16-17H,2,8-9,14-15,18-20H2,1H3,(H2,36,37,38)(H,45,46,47) |
| InChIKey | JGBHYDYOOMSEFH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 165.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|