C22H27N5OS — CID 15067664
3-[(6aR,9S)-7-cyano-5-(methylsulfanylmethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 15067664) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-[(6aR,9S)-7-cyano-5-(methylsulfanylmethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-7-cyano-5-(methylsulfanylmethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 15067664 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-[(6aR,9S)-7-cyano-5-(methylsulfanylmethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C=C2c3cccc4[nH]c(CSC)c(c34)C[C@H]2N(C#N)C1 |
| InChI | InChI=1S/C22H27N5OS/c1-4-26(5-2)22(28)24-14-9-16-15-7-6-8-18-21(15)17(19(25-18)12-29-3)10-20(16)27(11-14)13-23/h6-9,14,20,25H,4-5,10-12H2,1-3H3,(H,24,28)/t14-,20+/m0/s1 |
| InChIKey | GEQAJZYPWJGJEZ-VBKZILBWSA-N |
| XLogP | 3.56 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|