C23H28N2O5 — CID 150681071
2-[4-[4-(2-hydroxyphenyl)piperazin-1-yl]butyl]-4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 150681071) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyphenyl)piperazin-1-yl]butyl]-4-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 2-[4-[4-(2-hydroxyphenyl)piperazin-1-yl]butyl]-4-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150681071 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[4-[4-(2-hydroxyphenyl)piperazin-1-yl]butyl]-4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c(CCCCN2CCN(c3ccccc3O)CC2)c1C(=O)O |
| InChI | InChI=1S/C23H28N2O5/c1-16-9-10-18(22(27)28)17(21(16)23(29)30)6-4-5-11-24-12-14-25(15-13-24)19-7-2-3-8-20(19)26/h2-3,7-10,26H,4-6,11-15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | JHWMCEUAXABCMX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|